C12H18N2 — CID 66811554
[(2R,3R)-3-phenylpiperidin-2-yl]methanamine (PubChem CID 66811554) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is [(2R,3R)-3-phenylpiperidin-2-yl]methanamine.
| Compound Name | [(2R,3R)-3-phenylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 66811554 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | [(2R,3R)-3-phenylpiperidin-2-yl]methanamine |
| SMILES | NC[C@@H]1NCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H18N2/c13-9-12-11(7-4-8-14-12)10-5-2-1-3-6-10/h1-3,5-6,11-12,14H,4,7-9,13H2/t11-,12+/m1/s1 |
| InChIKey | QMGMVHVGCOUDLV-NEPJUHHUSA-N |
| XLogP | 1.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |