C11H15N — CID 121206987
[(1R,2R)-2-phenylcyclobutyl]methanamine (PubChem CID 121206987) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is [(1R,2R)-2-phenylcyclobutyl]methanamine.
| Compound Name | [(1R,2R)-2-phenylcyclobutyl]methanamine |
|---|---|
| PubChem CID | 121206987 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | [(1R,2R)-2-phenylcyclobutyl]methanamine |
| SMILES | NC[C@@H]1CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15N/c12-8-10-6-7-11(10)9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2/t10-,11-/m0/s1 |
| InChIKey | JTSHFZDOMOCTGE-QWRGUYRKSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |