C11H14O — CID 99991987
[(1S,2S)-2-phenylcyclobutyl]methanol (PubChem CID 99991987) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is [(1S,2S)-2-phenylcyclobutyl]methanol.
| Compound Name | [(1S,2S)-2-phenylcyclobutyl]methanol |
|---|---|
| PubChem CID | 99991987 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | [(1S,2S)-2-phenylcyclobutyl]methanol |
| SMILES | OC[C@H]1CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14O/c12-8-10-6-7-11(10)9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | XPEWLYMCTANANV-GHMZBOCLSA-N |
| XLogP | 2.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |