C12H17OZn- — CID 177478174
ethane;[(1R,2R)-2-phenylcyclopropyl]methanol;zinc (PubChem CID 177478174) has the molecular formula C12H17OZn- and a molecular weight of 242.66 g/mol. Its IUPAC name is ethane;[(1R,2R)-2-phenylcyclopropyl]methanol;zinc.
| Compound Name | ethane;[(1R,2R)-2-phenylcyclopropyl]methanol;zinc |
|---|---|
| PubChem CID | 177478174 |
| Molecular Formula | C12H17OZn- |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | ethane;[(1R,2R)-2-phenylcyclopropyl]methanol;zinc |
| SMILES | OC[C@@H]1C[C@H]1c1ccccc1.[CH2-]C.[Zn] |
| InChI | InChI=1S/C10H12O.C2H5.Zn/c11-7-9-6-10(9)8-4-2-1-3-5-8;1-2;/h1-5,9-11H,6-7H2;1H2,2H3;/q;-1;/t9-,10-;;/m0../s1 |
| InChIKey | BELBZIKAMICOSX-BZDVOYDHSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|