About [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol
[(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol (PubChem CID 11137881) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol |
| PubChem CID | 11137881 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol |
| SMILES | OC[C@H]1C[C@H]1[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H16O/c14-8-10-6-11(10)13-7-12(13)9-4-2-1-3-5-9/h1-5,10-14H,6-8H2/t10-,11-,12-,13-/m1/s1 |
| InChIKey | SNNZUVSAKBFUAR-FDYHWXHSSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol?
The IUPAC name of [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol (CID 11137881) is [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol.
What is the SMILES notation for [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol?
The canonical SMILES for [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol is OC[C@H]1C[C@H]1[C@H]1C[C@@H]1c1ccccc1.
What is the InChIKey of [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol?
The InChIKey is SNNZUVSAKBFUAR-FDYHWXHSSA-N. The full InChI is InChI=1S/C13H16O/c14-8-10-6-11(10)13-7-12(13)9-4-2-1-3-5-9/h1-5,10-14H,6-8H2/t10-,11-,12-,13-/m1/s1.
What are the key properties of [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol?
[(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol has a molecular weight of 188.27 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-[(1R,2S)-2-phenylcyclopropyl]cyclopropyl]methanol is sourced from PubChem (CID 11137881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).