C20H31N — CID 116518670
N-[[4-ethyl-2-(2-phenylcyclopropyl)cyclohexyl]methyl]ethanamine (PubChem CID 116518670) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is N-[[4-ethyl-2-(2-phenylcyclopropyl)cyclohexyl]methyl]ethanamine.
| Compound Name | N-[[4-ethyl-2-(2-phenylcyclopropyl)cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116518670 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-[[4-ethyl-2-(2-phenylcyclopropyl)cyclohexyl]methyl]ethanamine |
| SMILES | CCNCC1CCC(CC)CC1C1CC1c1ccccc1 |
| InChI | InChI=1S/C20H31N/c1-3-15-10-11-17(14-21-4-2)18(12-15)20-13-19(20)16-8-6-5-7-9-16/h5-9,15,17-21H,3-4,10-14H2,1-2H3 |
| InChIKey | HBXACAQEIYEBFD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |