C15H19 — CID 102445902
CID 102445902 (PubChem CID 102445902) has the molecular formula C15H19 and a molecular weight of 199.32 g/mol.
| Compound Name | CID 102445902 |
|---|---|
| PubChem CID | 102445902 |
| Molecular Formula | C15H19 |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | — |
| SMILES | C[C](C)[C@@H]1C[C@H]1[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H19/c1-10(2)12-8-14(12)15-9-13(15)11-6-4-3-5-7-11/h3-7,12-15H,8-9H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | TYLSZOBGFSKLQK-YJNKXOJESA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |