C21H22O2 — CID 10566591
(1R,4R,5R,6R,8R)-6-hydroxy-4,8-diphenylbicyclo[3.3.1]nonan-2-one (PubChem CID 10566591) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (1R,4R,5R,6R,8R)-6-hydroxy-4,8-diphenylbicyclo[3.3.1]nonan-2-one.
| Compound Name | (1R,4R,5R,6R,8R)-6-hydroxy-4,8-diphenylbicyclo[3.3.1]nonan-2-one |
|---|---|
| PubChem CID | 10566591 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (1R,4R,5R,6R,8R)-6-hydroxy-4,8-diphenylbicyclo[3.3.1]nonan-2-one |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@H]2C[C@@H]1[C@H](c1ccccc1)C[C@H]2O |
| InChI | InChI=1S/C21H22O2/c22-20-12-16(14-7-3-1-4-8-14)18-11-19(20)17(13-21(18)23)15-9-5-2-6-10-15/h1-10,16-20,22H,11-13H2/t16-,17-,18+,19+,20+/m0/s1 |
| InChIKey | SWWSUHKTFHMZBC-CENDIDJXSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |