C11H13FO — CID 105438736
[2-(3-fluorophenyl)cyclobutyl]methanol (PubChem CID 105438736) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is [2-(3-fluorophenyl)cyclobutyl]methanol.
| Compound Name | [2-(3-fluorophenyl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 105438736 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | [2-(3-fluorophenyl)cyclobutyl]methanol |
| SMILES | OCC1CCC1c1cccc(F)c1 |
| InChI | InChI=1S/C11H13FO/c12-10-3-1-2-8(6-10)11-5-4-9(11)7-13/h1-3,6,9,11,13H,4-5,7H2 |
| InChIKey | GSGFUXKFMVLCQF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |