C11H13FO — CID 26594918
cis-(1R,2R)-2-(3-fluorophenyl)cyclopentan-1-ol (PubChem CID 26594918) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is cis-(1R,2R)-2-(3-fluorophenyl)cyclopentan-1-ol.
| Compound Name | cis-(1R,2R)-2-(3-fluorophenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 26594918 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | cis-(1R,2R)-2-(3-fluorophenyl)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C11H13FO/c12-9-4-1-3-8(7-9)10-5-2-6-11(10)13/h1,3-4,7,10-11,13H,2,5-6H2/t10-,11-/m1/s1 |
| InChIKey | ARVGKJBSGIRSTQ-GHMZBOCLSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |