C11H15NO — CID 98008478
[(2R,3S)-3-phenylpyrrolidin-2-yl]methanol (PubChem CID 98008478) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is [(2R,3S)-3-phenylpyrrolidin-2-yl]methanol.
| Compound Name | [(2R,3S)-3-phenylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 98008478 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | [(2R,3S)-3-phenylpyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1NCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NO/c13-8-11-10(6-7-12-11)9-4-2-1-3-5-9/h1-5,10-13H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | SVTRYGCVYSRFIU-QWRGUYRKSA-N |
| XLogP | 1.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |