C12H17NO — CID 130754239
[(2S,3S)-3-benzylpyrrolidin-2-yl]methanol (PubChem CID 130754239) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is [(2S,3S)-3-benzylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,3S)-3-benzylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 130754239 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | [(2S,3S)-3-benzylpyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1NCC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO/c14-9-12-11(6-7-13-12)8-10-4-2-1-3-5-10/h1-5,11-14H,6-9H2/t11-,12-/m1/s1 |
| InChIKey | QLKDNIZATKTNLI-VXGBXAGGSA-N |
| XLogP | 1.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |