About (2S)-2-benzylazetidine;molecular hydrogen
(2S)-2-benzylazetidine;molecular hydrogen (PubChem CID 145023089) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is (2S)-2-benzylazetidine;molecular hydrogen.
Molecular Properties
| Compound Name | (2S)-2-benzylazetidine;molecular hydrogen |
| PubChem CID | 145023089 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (2S)-2-benzylazetidine;molecular hydrogen |
| SMILES | [H][H].c1ccc(C[C@H]2CCN2)cc1 |
| InChI | InChI=1S/C10H13N.H2/c1-2-4-9(5-3-1)8-10-6-7-11-10;/h1-5,10-11H,6-8H2;1H/t10-;/m1./s1 |
| InChIKey | FBVYTNULQIRDLN-HNCPQSOCSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-benzylazetidine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzylazetidine;molecular hydrogen?
The IUPAC name of (2S)-2-benzylazetidine;molecular hydrogen (CID 145023089) is (2S)-2-benzylazetidine;molecular hydrogen.
What is the SMILES notation for (2S)-2-benzylazetidine;molecular hydrogen?
The canonical SMILES for (2S)-2-benzylazetidine;molecular hydrogen is [H][H].c1ccc(C[C@H]2CCN2)cc1.
What is the InChIKey of (2S)-2-benzylazetidine;molecular hydrogen?
The InChIKey is FBVYTNULQIRDLN-HNCPQSOCSA-N. The full InChI is InChI=1S/C10H13N.H2/c1-2-4-9(5-3-1)8-10-6-7-11-10;/h1-5,10-11H,6-8H2;1H/t10-;/m1./s1.
What are the key properties of (2S)-2-benzylazetidine;molecular hydrogen?
(2S)-2-benzylazetidine;molecular hydrogen has a molecular weight of 149.24 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzylazetidine;molecular hydrogen is sourced from PubChem (CID 145023089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).