C13H20N2 — CID 101486734
(2S)-2-benzyl-1,4-diazocane (PubChem CID 101486734) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2S)-2-benzyl-1,4-diazocane.
| Compound Name | (2S)-2-benzyl-1,4-diazocane |
|---|---|
| PubChem CID | 101486734 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2S)-2-benzyl-1,4-diazocane |
| SMILES | c1ccc(C[C@H]2CNCCCCN2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-2-6-12(7-3-1)10-13-11-14-8-4-5-9-15-13/h1-3,6-7,13-15H,4-5,8-11H2/t13-/m0/s1 |
| InChIKey | AABZFZGYFNDFAV-ZDUSSCGKSA-N |
| XLogP | 1.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |