C15H25BrN4 — CID 174210894
(2S)-2-[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 174210894) has the molecular formula C15H25BrN4 and a molecular weight of 341.30 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 174210894 |
| Molecular Formula | C15H25BrN4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | Brc1ccc(C[C@H]2CNCCNCCNCCN2)cc1 |
| InChI | InChI=1S/C15H25BrN4/c16-14-3-1-13(2-4-14)11-15-12-19-8-7-17-5-6-18-9-10-20-15/h1-4,15,17-20H,5-12H2/t15-/m0/s1 |
| InChIKey | SYEAEILTFKJOCG-HNNXBMFYSA-N |
| XLogP | 0.73 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |