C17H31Cl2MnN5 — CID 59891255
2-benzyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese (PubChem CID 59891255) has the molecular formula C17H31Cl2MnN5 and a molecular weight of 431.31 g/mol. Its IUPAC name is 2-benzyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese.
| Compound Name | 2-benzyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese |
|---|---|
| PubChem CID | 59891255 |
| Molecular Formula | C17H31Cl2MnN5 |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-benzyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese |
| SMILES | Cl[Mn]Cl.c1ccc(CC2CNCCNCCNCCNCCN2)cc1 |
| InChI | InChI=1S/C17H31N5.2ClH.Mn/c1-2-4-16(5-3-1)14-17-15-21-11-10-19-7-6-18-8-9-20-12-13-22-17;;;/h1-5,17-22H,6-15H2;2*1H;/q;;;+2/p-2 |
| InChIKey | NETGKCMFYFGDMC-UHFFFAOYSA-L |
| XLogP | 0.94 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |