C17H31N5 — CID 46191915
N-benzyl-1-(1,4,7,10-tetrazacyclotridec-5-yl)methanamine (PubChem CID 46191915) has the molecular formula C17H31N5 and a molecular weight of 305.47 g/mol. Its IUPAC name is N-benzyl-1-(1,4,7,10-tetrazacyclotridec-5-yl)methanamine.
| Compound Name | N-benzyl-1-(1,4,7,10-tetrazacyclotridec-5-yl)methanamine |
|---|---|
| PubChem CID | 46191915 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | N-benzyl-1-(1,4,7,10-tetrazacyclotridec-5-yl)methanamine |
| SMILES | c1ccc(CNCC2CNCCNCCCNCCN2)cc1 |
| InChI | InChI=1S/C17H31N5/c1-2-5-16(6-3-1)13-21-15-17-14-20-10-9-18-7-4-8-19-11-12-22-17/h1-3,5-6,17-22H,4,7-15H2 |
| InChIKey | PGQDZRYMLRLGHX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |