C19H31N3O — CID 157061580
1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane (PubChem CID 157061580) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane.
| Compound Name | 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane |
|---|---|
| PubChem CID | 157061580 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane |
| SMILES | C.C#CCOc1ccc(CNCC2CCCCNCCN2)cc1 |
| InChI | InChI=1S/C18H27N3O.CH4/c1-2-13-22-18-8-6-16(7-9-18)14-20-15-17-5-3-4-10-19-11-12-21-17;/h1,6-9,17,19-21H,3-5,10-15H2;1H4 |
| InChIKey | ABJWQAOGADPQIK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|