About 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane
1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane (PubChem CID 157061580) has the molecular formula C19H31N3O
and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane.
Molecular Properties
| Compound Name | 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane |
| PubChem CID | 157061580 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane |
| SMILES | C.C#CCOc1ccc(CNCC2CCCCNCCN2)cc1 |
| InChI | InChI=1S/C18H27N3O.CH4/c1-2-13-22-18-8-6-16(7-9-18)14-20-15-17-5-3-4-10-19-11-12-21-17;/h1,6-9,17,19-21H,3-5,10-15H2;1H4 |
| InChIKey | ABJWQAOGADPQIK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane?
The IUPAC name of 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane (CID 157061580) is 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane.
What is the SMILES notation for 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane?
The canonical SMILES for 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane is C.C#CCOc1ccc(CNCC2CCCCNCCN2)cc1.
What is the InChIKey of 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane?
The InChIKey is ABJWQAOGADPQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O.CH4/c1-2-13-22-18-8-6-16(7-9-18)14-20-15-17-5-3-4-10-19-11-12-21-17;/h1,6-9,17,19-21H,3-5,10-15H2;1H4.
What are the key properties of 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane?
1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane has a molecular weight of 317.48 g/mol, XLogP of 2.16, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-diazonan-5-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;methane is sourced from PubChem (CID 157061580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).