C19H37N7 — CID 139968432
4-(1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl)aniline (PubChem CID 139968432) has the molecular formula C19H37N7 and a molecular weight of 363.55 g/mol. Its IUPAC name is 4-(1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl)aniline.
| Compound Name | 4-(1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 139968432 |
| Molecular Formula | C19H37N7 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | 4-(1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl)aniline |
| SMILES | Nc1ccc(CC2CNCCNCCNCCNCCNCCN2)cc1 |
| InChI | InChI=1S/C19H37N7/c20-18-3-1-17(2-4-18)15-19-16-25-12-11-23-8-7-21-5-6-22-9-10-24-13-14-26-19/h1-4,19,21-26H,5-16,20H2 |
| InChIKey | HUPQGBYNGNNFMN-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|