C24H41N5O8S — CID 173102322
acetic acid;(2S)-2-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 173102322) has the molecular formula C24H41N5O8S and a molecular weight of 559.69 g/mol. Its IUPAC name is acetic acid;(2S)-2-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | acetic acid;(2S)-2-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 173102322 |
| Molecular Formula | C24H41N5O8S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | acetic acid;(2S)-2-[(4-isothiocyanatophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.S=C=Nc1ccc(C[C@H]2CNCCNCCNCCN2)cc1 |
| InChI | InChI=1S/C16H25N5S.4C2H4O2/c22-13-21-15-3-1-14(2-4-15)11-16-12-19-8-7-17-5-6-18-9-10-20-16;4*1-2(3)4/h1-4,16-20H,5-12H2;4*1H3,(H,3,4)/t16-;;;;/m0..../s1 |
| InChIKey | OZZVLDXVSUILAU-FXAGWRDUSA-N |
| XLogP | 1.07 |
| TPSA | 209.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|