C17H31N5O — CID 21338454
2-(1,4,7,10,13-pentazacyclopentadec-2-ylmethyl)phenol (PubChem CID 21338454) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-(1,4,7,10,13-pentazacyclopentadec-2-ylmethyl)phenol.
| Compound Name | 2-(1,4,7,10,13-pentazacyclopentadec-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 21338454 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 2-(1,4,7,10,13-pentazacyclopentadec-2-ylmethyl)phenol |
| SMILES | Oc1ccccc1CC1CNCCNCCNCCNCCN1 |
| InChI | InChI=1S/C17H31N5O/c23-17-4-2-1-3-15(17)13-16-14-21-10-9-19-6-5-18-7-8-20-11-12-22-16/h1-4,16,18-23H,5-14H2 |
| InChIKey | AXFYUWLDCPGECC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |