C28H52Cl2N8 — CID 91582877
2-[[2,3-dichloro-4-(1,4,8,11-tetrazacyclotetradec-5-ylmethyl)phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane (PubChem CID 91582877) has the molecular formula C28H52Cl2N8 and a molecular weight of 571.69 g/mol. Its IUPAC name is 2-[[2,3-dichloro-4-(1,4,8,11-tetrazacyclotetradec-5-ylmethyl)phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 2-[[2,3-dichloro-4-(1,4,8,11-tetrazacyclotetradec-5-ylmethyl)phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 91582877 |
| Molecular Formula | C28H52Cl2N8 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | 2-[[2,3-dichloro-4-(1,4,8,11-tetrazacyclotetradec-5-ylmethyl)phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane |
| SMILES | Clc1c(CC2CCNCCNCCCNCCN2)ccc(CC2CNCCCNCCNCCCN2)c1Cl |
| InChI | InChI=1S/C28H52Cl2N8/c29-27-23(20-25-6-13-35-17-16-31-7-1-8-34-18-19-38-25)4-5-24(28(27)30)21-26-22-36-11-2-9-32-14-15-33-10-3-12-37-26/h4-5,25-26,31-38H,1-3,6-22H2 |
| InChIKey | CRORVRXCNAICDS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |