2-benzylpiperidine;pentanoic acid

C17H27NO2 — CID 174412963

IUPAC2-benzylpiperidine;pentanoic acid
SMILESCCCCC(=O)O.c1ccc(CC2CCCCN2)cc1
InChIInChI=1S/C12H17N.C5H10O2/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12;1-2-3-4-5(6)7/h1-3,6-7,12-13H,4-5,8-10H2;2-4H2,1H3,(H,6,7)
InChIKeyUAWBFPBSNYNHIF-UHFFFAOYSA-N
MW277.41 g/mol
LogP3.63
Rot. Bonds5

About 2-benzylpiperidine;pentanoic acid

2-benzylpiperidine;pentanoic acid (PubChem CID 174412963) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-benzylpiperidine;pentanoic acid.

Molecular Properties

Compound Name2-benzylpiperidine;pentanoic acid
PubChem CID174412963
Molecular FormulaC17H27NO2
Molecular Weight277.41 g/mol
Exact Mass277.20
IUPAC Name2-benzylpiperidine;pentanoic acid
SMILESCCCCC(=O)O.c1ccc(CC2CCCCN2)cc1
InChIInChI=1S/C12H17N.C5H10O2/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12;1-2-3-4-5(6)7/h1-3,6-7,12-13H,4-5,8-10H2;2-4H2,1H3,(H,6,7)
InChIKeyUAWBFPBSNYNHIF-UHFFFAOYSA-N
XLogP3.63
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.41
LogP ≤ 53.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-benzylpiperidine;pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzylpiperidine;pentanoic acid?
The IUPAC name of 2-benzylpiperidine;pentanoic acid (CID 174412963) is 2-benzylpiperidine;pentanoic acid.
What is the SMILES notation for 2-benzylpiperidine;pentanoic acid?
The canonical SMILES for 2-benzylpiperidine;pentanoic acid is CCCCC(=O)O.c1ccc(CC2CCCCN2)cc1.
What is the InChIKey of 2-benzylpiperidine;pentanoic acid?
The InChIKey is UAWBFPBSNYNHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.C5H10O2/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12;1-2-3-4-5(6)7/h1-3,6-7,12-13H,4-5,8-10H2;2-4H2,1H3,(H,6,7).
What are the key properties of 2-benzylpiperidine;pentanoic acid?
2-benzylpiperidine;pentanoic acid has a molecular weight of 277.41 g/mol, XLogP of 3.63, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpiperidine;pentanoic acid is sourced from PubChem (CID 174412963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).