C17H27NO2 — CID 174412963
2-benzylpiperidine;pentanoic acid (PubChem CID 174412963) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-benzylpiperidine;pentanoic acid.
| Compound Name | 2-benzylpiperidine;pentanoic acid |
|---|---|
| PubChem CID | 174412963 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-benzylpiperidine;pentanoic acid |
| SMILES | CCCCC(=O)O.c1ccc(CC2CCCCN2)cc1 |
| InChI | InChI=1S/C12H17N.C5H10O2/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12;1-2-3-4-5(6)7/h1-3,6-7,12-13H,4-5,8-10H2;2-4H2,1H3,(H,6,7) |
| InChIKey | UAWBFPBSNYNHIF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |