About 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid
1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid (PubChem CID 143873908) has the molecular formula C20H27NO3
and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid.
Molecular Properties
| Compound Name | 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid |
| PubChem CID | 143873908 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid |
| SMILES | COc1cccc2ccccc12.O=C(O)CCCC1CCCCN1 |
| InChI | InChI=1S/C11H10O.C9H17NO2/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;11-9(12)6-3-5-8-4-1-2-7-10-8/h2-8H,1H3;8,10H,1-7H2,(H,11,12) |
| InChIKey | JSPMUXLIBZRJGO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid?
The IUPAC name of 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid (CID 143873908) is 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid.
What is the SMILES notation for 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid?
The canonical SMILES for 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid is COc1cccc2ccccc12.O=C(O)CCCC1CCCCN1.
What is the InChIKey of 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid?
The InChIKey is JSPMUXLIBZRJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.C9H17NO2/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;11-9(12)6-3-5-8-4-1-2-7-10-8/h2-8H,1H3;8,10H,1-7H2,(H,11,12).
What are the key properties of 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid?
1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid has a molecular weight of 329.44 g/mol, XLogP of 4.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxynaphthalene;4-piperidin-2-ylbutanoic acid is sourced from PubChem (CID 143873908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).