About 3-benzylpyrazolidine
3-benzylpyrazolidine (PubChem CID 138058728) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-benzylpyrazolidine.
Molecular Properties
| Compound Name | 3-benzylpyrazolidine |
| PubChem CID | 138058728 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-benzylpyrazolidine |
| SMILES | c1ccc(CC2CCNN2)cc1 |
| InChI | InChI=1S/C10H14N2/c1-2-4-9(5-3-1)8-10-6-7-11-12-10/h1-5,10-12H,6-8H2 |
| InChIKey | HHHUMCWAHUPRBX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylpyrazolidine?
The IUPAC name of 3-benzylpyrazolidine (CID 138058728) is 3-benzylpyrazolidine.
What is the SMILES notation for 3-benzylpyrazolidine?
The canonical SMILES for 3-benzylpyrazolidine is c1ccc(CC2CCNN2)cc1.
What is the InChIKey of 3-benzylpyrazolidine?
The InChIKey is HHHUMCWAHUPRBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-4-9(5-3-1)8-10-6-7-11-12-10/h1-5,10-12H,6-8H2.
What are the key properties of 3-benzylpyrazolidine?
3-benzylpyrazolidine has a molecular weight of 162.24 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylpyrazolidine is sourced from PubChem (CID 138058728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).