About 6-benzylpiperidin-2-ol
6-benzylpiperidin-2-ol (PubChem CID 163764963) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 6-benzylpiperidin-2-ol.
Molecular Properties
| Compound Name | 6-benzylpiperidin-2-ol |
| PubChem CID | 163764963 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 6-benzylpiperidin-2-ol |
| SMILES | OC1CCCC(Cc2ccccc2)N1 |
| InChI | InChI=1S/C12H17NO/c14-12-8-4-7-11(13-12)9-10-5-2-1-3-6-10/h1-3,5-6,11-14H,4,7-9H2 |
| InChIKey | MBLMMEZBZDJFRM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-benzylpiperidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylpiperidin-2-ol?
The IUPAC name of 6-benzylpiperidin-2-ol (CID 163764963) is 6-benzylpiperidin-2-ol.
What is the SMILES notation for 6-benzylpiperidin-2-ol?
The canonical SMILES for 6-benzylpiperidin-2-ol is OC1CCCC(Cc2ccccc2)N1.
What is the InChIKey of 6-benzylpiperidin-2-ol?
The InChIKey is MBLMMEZBZDJFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c14-12-8-4-7-11(13-12)9-10-5-2-1-3-6-10/h1-3,5-6,11-14H,4,7-9H2.
What are the key properties of 6-benzylpiperidin-2-ol?
6-benzylpiperidin-2-ol has a molecular weight of 191.27 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylpiperidin-2-ol is sourced from PubChem (CID 163764963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).