C22H29N — CID 44563173
(2S,6S)-2-(2-phenylethyl)-6-(3-phenylpropyl)piperidine (PubChem CID 44563173) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is (2S,6S)-2-(2-phenylethyl)-6-(3-phenylpropyl)piperidine.
| Compound Name | (2S,6S)-2-(2-phenylethyl)-6-(3-phenylpropyl)piperidine |
|---|---|
| PubChem CID | 44563173 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (2S,6S)-2-(2-phenylethyl)-6-(3-phenylpropyl)piperidine |
| SMILES | c1ccc(CCC[C@H]2CCC[C@@H](CCc3ccccc3)N2)cc1 |
| InChI | InChI=1S/C22H29N/c1-3-9-19(10-4-1)13-7-14-21-15-8-16-22(23-21)18-17-20-11-5-2-6-12-20/h1-6,9-12,21-23H,7-8,13-18H2/t21-,22-/m0/s1 |
| InChIKey | IRUNRQBPUVWDKY-VXKWHMMOSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |