C19H24ClN — CID 70526250
(2R,5R)-2-benzyl-5-(2-phenylethyl)pyrrolidine;hydrochloride (PubChem CID 70526250) has the molecular formula C19H24ClN and a molecular weight of 301.86 g/mol. Its IUPAC name is (2R,5R)-2-benzyl-5-(2-phenylethyl)pyrrolidine;hydrochloride.
| Compound Name | (2R,5R)-2-benzyl-5-(2-phenylethyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 70526250 |
| Molecular Formula | C19H24ClN |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (2R,5R)-2-benzyl-5-(2-phenylethyl)pyrrolidine;hydrochloride |
| SMILES | Cl.c1ccc(CC[C@@H]2CC[C@H](Cc3ccccc3)N2)cc1 |
| InChI | InChI=1S/C19H23N.ClH/c1-3-7-16(8-4-1)11-12-18-13-14-19(20-18)15-17-9-5-2-6-10-17;/h1-10,18-20H,11-15H2;1H/t18-,19-;/m1./s1 |
| InChIKey | QOJVWFICDWYRHH-STYNFMPRSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |