C20H24O — CID 11108749
(2S,5S)-2,5-bis(2-phenylethyl)oxolane (PubChem CID 11108749) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is (2S,5S)-2,5-bis(2-phenylethyl)oxolane.
| Compound Name | (2S,5S)-2,5-bis(2-phenylethyl)oxolane |
|---|---|
| PubChem CID | 11108749 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2S,5S)-2,5-bis(2-phenylethyl)oxolane |
| SMILES | c1ccc(CC[C@H]2CC[C@H](CCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H24O/c1-3-7-17(8-4-1)11-13-19-15-16-20(21-19)14-12-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2/t19-,20-/m0/s1 |
| InChIKey | BHDZPAIDGMVJNA-PMACEKPBSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |