About ethane;2-(2-phenylethyl)oxirane;propane
ethane;2-(2-phenylethyl)oxirane;propane (PubChem CID 90817072) has the molecular formula C21H44O
and a molecular weight of 312.58 g/mol. Its IUPAC name is ethane;2-(2-phenylethyl)oxirane;propane.
Molecular Properties
| Compound Name | ethane;2-(2-phenylethyl)oxirane;propane |
| PubChem CID | 90817072 |
| Molecular Formula | C21H44O |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | ethane;2-(2-phenylethyl)oxirane;propane |
| SMILES | CC.CC.CC.CC.CCC.c1ccc(CCC2CO2)cc1 |
| InChI | InChI=1S/C10H12O.C3H8.4C2H6/c1-2-4-9(5-3-1)6-7-10-8-11-10;1-3-2;4*1-2/h1-5,10H,6-8H2;3H2,1-2H3;4*1-2H3 |
| InChIKey | MWWOULGZJQHALL-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(2-phenylethyl)oxirane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-phenylethyl)oxirane;propane?
The IUPAC name of ethane;2-(2-phenylethyl)oxirane;propane (CID 90817072) is ethane;2-(2-phenylethyl)oxirane;propane.
What is the SMILES notation for ethane;2-(2-phenylethyl)oxirane;propane?
The canonical SMILES for ethane;2-(2-phenylethyl)oxirane;propane is CC.CC.CC.CC.CCC.c1ccc(CCC2CO2)cc1.
What is the InChIKey of ethane;2-(2-phenylethyl)oxirane;propane?
The InChIKey is MWWOULGZJQHALL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C3H8.4C2H6/c1-2-4-9(5-3-1)6-7-10-8-11-10;1-3-2;4*1-2/h1-5,10H,6-8H2;3H2,1-2H3;4*1-2H3.
What are the key properties of ethane;2-(2-phenylethyl)oxirane;propane?
ethane;2-(2-phenylethyl)oxirane;propane has a molecular weight of 312.58 g/mol, XLogP of 7.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-phenylethyl)oxirane;propane is sourced from PubChem (CID 90817072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).