C12H16O2 — CID 59041484
(2S)-4-methyl-2-(2-phenylethyl)-1,3-dioxolane (PubChem CID 59041484) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2S)-4-methyl-2-(2-phenylethyl)-1,3-dioxolane.
| Compound Name | (2S)-4-methyl-2-(2-phenylethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 59041484 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2S)-4-methyl-2-(2-phenylethyl)-1,3-dioxolane |
| SMILES | CC1CO[C@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C12H16O2/c1-10-9-13-12(14-10)8-7-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t10?,12-/m0/s1 |
| InChIKey | XYKVFYYSMNGELO-KFJBMODSSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |