C24H26O3 — CID 175322944
4-methyl-2-phenyl-1,3-dioxolane;phenylmethoxymethylbenzene (PubChem CID 175322944) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,3-dioxolane;phenylmethoxymethylbenzene.
| Compound Name | 4-methyl-2-phenyl-1,3-dioxolane;phenylmethoxymethylbenzene |
|---|---|
| PubChem CID | 175322944 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-methyl-2-phenyl-1,3-dioxolane;phenylmethoxymethylbenzene |
| SMILES | CC1COC(c2ccccc2)O1.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C10H12O2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-8-7-11-10(12-8)9-5-3-2-4-6-9/h1-10H,11-12H2;2-6,8,10H,7H2,1H3 |
| InChIKey | LUXABOFYKJYTIL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |