C20H24O5 — CID 11313942
(4S,5R)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-phenyl-1,3-dioxan-5-ol (PubChem CID 11313942) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (4S,5R)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (4S,5R)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 11313942 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4S,5R)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-phenyl-1,3-dioxan-5-ol |
| SMILES | COc1ccc(COCC[C@@H]2OC(c3ccccc3)OC[C@H]2O)cc1 |
| InChI | InChI=1S/C20H24O5/c1-22-17-9-7-15(8-10-17)13-23-12-11-19-18(21)14-24-20(25-19)16-5-3-2-4-6-16/h2-10,18-21H,11-14H2,1H3/t18-,19+,20?/m1/s1 |
| InChIKey | GSGPPHATMQGKGU-LFPSWIHMSA-N |
| XLogP | 3.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|