C31H30O4 — CID 16754653
(4S,5R)-2-phenyl-4-(2-trityloxyethyl)-1,3-dioxan-5-ol (PubChem CID 16754653) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is (4S,5R)-2-phenyl-4-(2-trityloxyethyl)-1,3-dioxan-5-ol.
| Compound Name | (4S,5R)-2-phenyl-4-(2-trityloxyethyl)-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 16754653 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (4S,5R)-2-phenyl-4-(2-trityloxyethyl)-1,3-dioxan-5-ol |
| SMILES | O[C@@H]1COC(c2ccccc2)O[C@H]1CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30O4/c32-28-23-33-30(24-13-5-1-6-14-24)35-29(28)21-22-34-31(25-15-7-2-8-16-25,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,28-30,32H,21-23H2/t28-,29+,30?/m1/s1 |
| InChIKey | LKLWTTOQEVWKGD-RAVAVGQKSA-N |
| XLogP | 5.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|