C21H26O5 — CID 11268344
(4S,5S)-4-[3-[(4-methoxyphenyl)methoxy]propyl]-2-phenyl-1,3-dioxan-5-ol (PubChem CID 11268344) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (4S,5S)-4-[3-[(4-methoxyphenyl)methoxy]propyl]-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (4S,5S)-4-[3-[(4-methoxyphenyl)methoxy]propyl]-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 11268344 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4S,5S)-4-[3-[(4-methoxyphenyl)methoxy]propyl]-2-phenyl-1,3-dioxan-5-ol |
| SMILES | COc1ccc(COCCC[C@@H]2OC(c3ccccc3)OC[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H26O5/c1-23-18-11-9-16(10-12-18)14-24-13-5-8-20-19(22)15-25-21(26-20)17-6-3-2-4-7-17/h2-4,6-7,9-12,19-22H,5,8,13-15H2,1H3/t19-,20-,21?/m0/s1 |
| InChIKey | WGWQURHDAFMKTJ-AHTKWCMKSA-N |
| XLogP | 3.47 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|