C22H22O4 — CID 71170081
(4S)-4-(naphthalen-2-ylmethoxymethyl)-2-phenyl-1,3-dioxan-5-ol (PubChem CID 71170081) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (4S)-4-(naphthalen-2-ylmethoxymethyl)-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (4S)-4-(naphthalen-2-ylmethoxymethyl)-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 71170081 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (4S)-4-(naphthalen-2-ylmethoxymethyl)-2-phenyl-1,3-dioxan-5-ol |
| SMILES | OC1COC(c2ccccc2)O[C@H]1COCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22O4/c23-20-14-25-22(18-7-2-1-3-8-18)26-21(20)15-24-13-16-10-11-17-6-4-5-9-19(17)12-16/h1-12,20-23H,13-15H2/t20?,21-,22?/m0/s1 |
| InChIKey | LPNKLEBWQCYQBK-ORFBVSJDSA-N |
| XLogP | 3.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |