C47H52O9 — CID 73054112
(4R,5R)-2-(4-methoxyphenyl)-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxan-5-ol (PubChem CID 73054112) has the molecular formula C47H52O9 and a molecular weight of 760.92 g/mol. Its IUPAC name is (4R,5R)-2-(4-methoxyphenyl)-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxan-5-ol.
| Compound Name | (4R,5R)-2-(4-methoxyphenyl)-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 73054112 |
| Molecular Formula | C47H52O9 |
| Molecular Weight | 760.92 g/mol |
| Exact Mass | 760.36 |
| IUPAC Name | (4R,5R)-2-(4-methoxyphenyl)-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxan-5-ol |
| SMILES | COc1ccc(C2OC[C@@H](O)[C@@H](CC[C@@H]3O[C@H](COCc4ccccc4)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C47H52O9/c1-49-39-24-22-38(23-25-39)47-54-32-40(48)41(56-47)26-27-42-44(51-29-35-16-8-3-9-17-35)46(53-31-37-20-12-5-13-21-37)45(52-30-36-18-10-4-11-19-36)43(55-42)33-50-28-34-14-6-2-7-15-34/h2-25,40-48H,26-33H2,1H3/t40-,41-,42+,43-,44+,45+,46-,47?/m1/s1 |
| InChIKey | YCYRQWWPJMYRIN-WOZOLLMNSA-N |
| XLogP | 7.99 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.92 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |