C54H58O9 — CID 73054113
(4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxy-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxane (PubChem CID 73054113) has the molecular formula C54H58O9 and a molecular weight of 851.05 g/mol. Its IUPAC name is (4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxy-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxane.
| Compound Name | (4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxy-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 73054113 |
| Molecular Formula | C54H58O9 |
| Molecular Weight | 851.05 g/mol |
| Exact Mass | 850.41 |
| IUPAC Name | (4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxy-4-[2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-1,3-dioxane |
| SMILES | COc1ccc(C2OC[C@@H](OCc3ccccc3)[C@@H](CC[C@@H]3O[C@H](COCc4ccccc4)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C54H58O9/c1-55-46-29-27-45(28-30-46)54-61-39-49(57-34-41-19-9-3-10-20-41)47(63-54)31-32-48-51(58-35-42-21-11-4-12-22-42)53(60-37-44-25-15-6-16-26-44)52(59-36-43-23-13-5-14-24-43)50(62-48)38-56-33-40-17-7-2-8-18-40/h2-30,47-54H,31-39H2,1H3/t47-,48+,49-,50-,51+,52+,53-,54?/m1/s1 |
| InChIKey | KILVWWCOAPUZDM-MVSTYIQOSA-N |
| XLogP | 10.22 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.05 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |