C36H35NO5 — CID 102214995
(4S)-4-[[(4R,5S)-2-phenyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one (PubChem CID 102214995) has the molecular formula C36H35NO5 and a molecular weight of 561.68 g/mol. Its IUPAC name is (4S)-4-[[(4R,5S)-2-phenyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one.
| Compound Name | (4S)-4-[[(4R,5S)-2-phenyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one |
|---|---|
| PubChem CID | 102214995 |
| Molecular Formula | C36H35NO5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (4S)-4-[[(4R,5S)-2-phenyl-4-(trityloxymethyl)-1,3-dioxan-5-yl]oxy]-3-propan-2-ylideneazetidin-2-one |
| SMILES | CC(C)=C1C(=O)N[C@H]1O[C@H]1COC(c2ccccc2)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H35NO5/c1-25(2)32-33(38)37-34(32)41-30-23-39-35(26-15-7-3-8-16-26)42-31(30)24-40-36(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,30-31,34-35H,23-24H2,1-2H3,(H,37,38)/t30-,31+,34-,35?/m0/s1 |
| InChIKey | LFQIJIBEAWPZTR-HIPSBMEASA-N |
| XLogP | 6.29 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|