C17H28O4Si — CID 102054254
[(2R,4S,5R)-2-phenyl-5-triethylsilyloxy-1,3-dioxan-4-yl]methanol (PubChem CID 102054254) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is [(2R,4S,5R)-2-phenyl-5-triethylsilyloxy-1,3-dioxan-4-yl]methanol.
| Compound Name | [(2R,4S,5R)-2-phenyl-5-triethylsilyloxy-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 102054254 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(2R,4S,5R)-2-phenyl-5-triethylsilyloxy-1,3-dioxan-4-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CO[C@@H](c2ccccc2)O[C@H]1CO |
| InChI | InChI=1S/C17H28O4Si/c1-4-22(5-2,6-3)21-16-13-19-17(20-15(16)12-18)14-10-8-7-9-11-14/h7-11,15-18H,4-6,12-13H2,1-3H3/t15-,16+,17+/m0/s1 |
| InChIKey | KMVNTDCULMGXIS-GVDBMIGSSA-N |
| XLogP | 3.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|