C21H32O5Si — CID 11811274
methyl (E)-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 11811274) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is methyl (E)-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 11811274 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methyl (E)-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@H]1O[C@H](c2ccccc2)OC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O5Si/c1-21(2,3)27(5,6)26-18-15-24-20(16-11-8-7-9-12-16)25-17(18)13-10-14-19(22)23-4/h7-12,14,17-18,20H,13,15H2,1-6H3/b14-10+/t17-,18+,20+/m0/s1 |
| InChIKey | AECXBMBTFUSAKG-YPMIKLJDSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|