C23H36O5Si — CID 59558876
methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate (PubChem CID 59558876) has the molecular formula C23H36O5Si and a molecular weight of 420.62 g/mol. Its IUPAC name is methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59558876 |
| Molecular Formula | C23H36O5Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1OC(c2ccccc2)OC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36O5Si/c1-16(2)29(17(3)4,18(5)6)28-21-15-26-23(19-11-9-8-10-12-19)27-20(21)13-14-22(24)25-7/h8-14,16-18,20-21,23H,15H2,1-7H3/b14-13+/t20-,21+,23?/m0/s1 |
| InChIKey | OGJMAGYEHBFWOJ-DBQMSWEASA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|