C17H20O6 — CID 11278641
ethyl (E)-3-[(2R,3R)-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]prop-2-enoate (PubChem CID 11278641) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3R)-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3R)-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11278641 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | ethyl (E)-3-[(2R,3R)-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@H]1[C@@H]1O[C@H](c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C17H20O6/c1-2-20-14(19)9-8-13-16(22-13)15-12(18)10-21-17(23-15)11-6-4-3-5-7-11/h3-9,12-13,15-18H,2,10H2,1H3/b9-8+/t12-,13-,15-,16-,17-/m1/s1 |
| InChIKey | DVEAAGARNNZNLJ-XQNPYOHISA-N |
| XLogP | 1.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|