C13H14O5 — CID 70003261
(E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoic acid (PubChem CID 70003261) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70003261 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/[C@@H]1OC(c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C13H14O5/c14-10-8-17-13(9-4-2-1-3-5-9)18-11(10)6-7-12(15)16/h1-7,10-11,13-14H,8H2,(H,15,16)/b7-6+/t10-,11+,13?/m1/s1 |
| InChIKey | UISIUGCXCQBKEP-NTRRDSCNSA-N |
| XLogP | 1.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|