C13H17NO2 — CID 167196970
(4R,5S)-2-phenyl-4-[(E)-prop-1-enyl]-1,3-dioxan-5-amine (PubChem CID 167196970) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (4R,5S)-2-phenyl-4-[(E)-prop-1-enyl]-1,3-dioxan-5-amine.
| Compound Name | (4R,5S)-2-phenyl-4-[(E)-prop-1-enyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 167196970 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (4R,5S)-2-phenyl-4-[(E)-prop-1-enyl]-1,3-dioxan-5-amine |
| SMILES | C/C=C/[C@H]1OC(c2ccccc2)OC[C@@H]1N |
| InChI | InChI=1S/C13H17NO2/c1-2-6-12-11(14)9-15-13(16-12)10-7-4-3-5-8-10/h2-8,11-13H,9,14H2,1H3/b6-2+/t11-,12+,13?/m0/s1 |
| InChIKey | AADDPVRCYSVWME-UEVRIQCWSA-N |
| XLogP | 2.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|