C13H18O2 — CID 13289090
4-tert-butyl-2-phenyl-1,3-dioxolane (PubChem CID 13289090) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-tert-butyl-2-phenyl-1,3-dioxolane.
| Compound Name | 4-tert-butyl-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 13289090 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-tert-butyl-2-phenyl-1,3-dioxolane |
| SMILES | CC(C)(C)C1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C13H18O2/c1-13(2,3)11-9-14-12(15-11)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3 |
| InChIKey | NDZWSPTYULPRLU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |