C11H10O2 — CID 85419917
4-ethynyl-2-phenyl-1,3-dioxolane (PubChem CID 85419917) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-ethynyl-2-phenyl-1,3-dioxolane.
| Compound Name | 4-ethynyl-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 85419917 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 4-ethynyl-2-phenyl-1,3-dioxolane |
| SMILES | C#CC1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C11H10O2/c1-2-10-8-12-11(13-10)9-6-4-3-5-7-9/h1,3-7,10-11H,8H2 |
| InChIKey | KICXGGIOPOWKSU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|