C37H52O10Si — CID 159075951
methyl (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate;methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate (PubChem CID 159075951) has the molecular formula C37H52O10Si and a molecular weight of 684.90 g/mol. Its IUPAC name is methyl (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate;methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate;methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 159075951 |
| Molecular Formula | C37H52O10Si |
| Molecular Weight | 684.90 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | methyl (E)-3-[(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate;methyl (E)-3-[(4S,5R)-2-phenyl-5-tri(propan-2-yl)silyloxy-1,3-dioxan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1OC(c2ccccc2)OC[C@H]1O.COC(=O)/C=C/[C@@H]1OC(c2ccccc2)OC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36O5Si.C14H16O5/c1-16(2)29(17(3)4,18(5)6)28-21-15-26-23(19-11-9-8-10-12-19)27-20(21)13-14-22(24)25-7;1-17-13(16)8-7-12-11(15)9-18-14(19-12)10-5-3-2-4-6-10/h8-14,16-18,20-21,23H,15H2,1-7H3;2-8,11-12,14-15H,9H2,1H3/b14-13+;8-7+/t20-,21+,23?;11-,12+,14?/m01/s1 |
| InChIKey | KAGFLBDZJWQNKL-MTCBKQFSSA-N |
| XLogP | 6.58 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.90 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|