C22H26O3Si — CID 15807828
methyl (E)-3-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxiran-2-yl]prop-2-enoate (PubChem CID 15807828) has the molecular formula C22H26O3Si and a molecular weight of 366.53 g/mol. Its IUPAC name is methyl (E)-3-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxiran-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15807828 |
| Molecular Formula | C22H26O3Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | methyl (E)-3-[(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxiran-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1O[C@H]1[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H26O3Si/c1-22(2,3)26(17-11-7-5-8-12-17,18-13-9-6-10-14-18)21-19(25-21)15-16-20(23)24-4/h5-16,19,21H,1-4H3/b16-15+/t19-,21-/m0/s1 |
| InChIKey | ARNLSCDELWKSJK-YWBNNAAISA-N |
| XLogP | 3.09 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|