C23H28OSi — CID 102426679
tert-butyl-[(2S,3S)-3-[(1Z)-3-methylbuta-1,3-dienyl]oxiran-2-yl]-diphenylsilane (PubChem CID 102426679) has the molecular formula C23H28OSi and a molecular weight of 348.56 g/mol. Its IUPAC name is tert-butyl-[(2S,3S)-3-[(1Z)-3-methylbuta-1,3-dienyl]oxiran-2-yl]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3S)-3-[(1Z)-3-methylbuta-1,3-dienyl]oxiran-2-yl]-diphenylsilane |
|---|---|
| PubChem CID | 102426679 |
| Molecular Formula | C23H28OSi |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | tert-butyl-[(2S,3S)-3-[(1Z)-3-methylbuta-1,3-dienyl]oxiran-2-yl]-diphenylsilane |
| SMILES | C=C(C)/C=C\[C@@H]1O[C@H]1[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H28OSi/c1-18(2)16-17-21-22(24-21)25(23(3,4)5,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-17,21-22H,1H2,2-5H3/b17-16-/t21-,22-/m0/s1 |
| InChIKey | YLCMJDIFKFZDJK-JNJZGVDNSA-N |
| XLogP | 4.49 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|